C30H33N5O4S — CID 19420719
1-[4-[[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]sulfamoyl]phenyl]-3-(2-phenylethyl)urea (PubChem CID 19420719) has the molecular formula C30H33N5O4S and a molecular weight of 559.69 g/mol. Its IUPAC name is 1-[4-[[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]sulfamoyl]phenyl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[4-[[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]sulfamoyl]phenyl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 19420719 |
| Molecular Formula | C30H33N5O4S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 1-[4-[[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]sulfamoyl]phenyl]-3-(2-phenylethyl)urea |
| SMILES | O=C(NCCc1ccccc1)Nc1ccc(S(=O)(=O)Nc2ccc(CCNCC(O)c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C30H33N5O4S/c36-29(25-7-4-18-31-21-25)22-32-19-16-24-8-10-27(11-9-24)35-40(38,39)28-14-12-26(13-15-28)34-30(37)33-20-17-23-5-2-1-3-6-23/h1-15,18,21,29,32,35-36H,16-17,19-20,22H2,(H2,33,34,37) |
| InChIKey | OQCZSKDYAKSTBO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|