C31H38N4O4S — CID 19420495
4-(2-heptyl-1,3-oxazol-4-yl)-N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]benzenesulfonamide (PubChem CID 19420495) has the molecular formula C31H38N4O4S and a molecular weight of 562.74 g/mol. Its IUPAC name is 4-(2-heptyl-1,3-oxazol-4-yl)-N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 4-(2-heptyl-1,3-oxazol-4-yl)-N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19420495 |
| Molecular Formula | C31H38N4O4S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 4-(2-heptyl-1,3-oxazol-4-yl)-N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]benzenesulfonamide |
| SMILES | CCCCCCCc1nc(-c2ccc(S(=O)(=O)Nc3ccc(CCNCC(O)c4cccnc4)cc3)cc2)co1 |
| InChI | InChI=1S/C31H38N4O4S/c1-2-3-4-5-6-9-31-34-29(23-39-31)25-12-16-28(17-13-25)40(37,38)35-27-14-10-24(11-15-27)18-20-33-22-30(36)26-8-7-19-32-21-26/h7-8,10-17,19,21,23,30,33,35-36H,2-6,9,18,20,22H2,1H3 |
| InChIKey | TVHQKRMHTJEMMR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|