C31H37N5O3S2 — CID 19420557
N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-1-(5-pentyl-1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 19420557) has the molecular formula C31H37N5O3S2 and a molecular weight of 591.80 g/mol. Its IUPAC name is N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-1-(5-pentyl-1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-1-(5-pentyl-1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 19420557 |
| Molecular Formula | C31H37N5O3S2 |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-1-(5-pentyl-1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCCCCc1cnc(N2CCc3cc(S(=O)(=O)Nc4ccc(CCNCC(O)c5cccnc5)cc4)ccc32)s1 |
| InChI | InChI=1S/C31H37N5O3S2/c1-2-3-4-7-27-21-34-31(40-27)36-18-15-24-19-28(12-13-29(24)36)41(38,39)35-26-10-8-23(9-11-26)14-17-33-22-30(37)25-6-5-16-32-20-25/h5-6,8-13,16,19-21,30,33,35,37H,2-4,7,14-15,17-18,22H2,1H3 |
| InChIKey | QRHXIIPOBUTRSP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|