C33H43Cl2N5O4S — CID 19420529
5-[[4-[2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]-N-octyl-2,3-dihydroindole-1-carboxamide (PubChem CID 19420529) has the molecular formula C33H43Cl2N5O4S and a molecular weight of 676.71 g/mol. Its IUPAC name is 5-[[4-[2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]-N-octyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | 5-[[4-[2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]-N-octyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 19420529 |
| Molecular Formula | C33H43Cl2N5O4S |
| Molecular Weight | 676.71 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | 5-[[4-[2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]-N-octyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)N1CCc2cc(S(=O)(=O)Nc3ccc(CCNCC(O)c4cc(Cl)c(N)c(Cl)c4)cc3)ccc21 |
| InChI | InChI=1S/C33H43Cl2N5O4S/c1-2-3-4-5-6-7-16-38-33(42)40-18-15-24-19-27(12-13-30(24)40)45(43,44)39-26-10-8-23(9-11-26)14-17-37-22-31(41)25-20-28(34)32(36)29(35)21-25/h8-13,19-21,31,37,39,41H,2-7,14-18,22,36H2,1H3,(H,38,42) |
| InChIKey | IPNCEZDRQMAELB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|