C35H42N4O3S — CID 100970828
1-(3-hexylphenyl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 100970828) has the molecular formula C35H42N4O3S and a molecular weight of 598.81 g/mol. Its IUPAC name is 1-(3-hexylphenyl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(3-hexylphenyl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 100970828 |
| Molecular Formula | C35H42N4O3S |
| Molecular Weight | 598.81 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 1-(3-hexylphenyl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCCCCCc1cccc(N2CCc3cc(S(=O)(=O)Nc4ccc(CCNC[C@H](O)c5cccnc5)cc4)ccc32)c1 |
| InChI | InChI=1S/C35H42N4O3S/c1-2-3-4-5-8-28-9-6-11-32(23-28)39-22-19-29-24-33(16-17-34(29)39)43(41,42)38-31-14-12-27(13-15-31)18-21-37-26-35(40)30-10-7-20-36-25-30/h6-7,9-17,20,23-25,35,37-38,40H,2-5,8,18-19,21-22,26H2,1H3/t35-/m0/s1 |
| InChIKey | IKJCZZNWKHFEHM-DHUJRADRSA-N |
| XLogP | 6.57 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.81 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|