C34H43N5O4S — CID 67691412
N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-N-(5-octyl-1,3-oxazol-2-yl)-2,3-dihydro-1H-indole-5-sulfonamide (PubChem CID 67691412) has the molecular formula C34H43N5O4S and a molecular weight of 617.82 g/mol. Its IUPAC name is N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-N-(5-octyl-1,3-oxazol-2-yl)-2,3-dihydro-1H-indole-5-sulfonamide.
| Compound Name | N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-N-(5-octyl-1,3-oxazol-2-yl)-2,3-dihydro-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 67691412 |
| Molecular Formula | C34H43N5O4S |
| Molecular Weight | 617.82 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-N-(5-octyl-1,3-oxazol-2-yl)-2,3-dihydro-1H-indole-5-sulfonamide |
| SMILES | CCCCCCCCc1cnc(N(c2ccc(CCNCC(O)c3cccnc3)cc2)S(=O)(=O)c2ccc3c(c2)CCN3)o1 |
| InChI | InChI=1S/C34H43N5O4S/c1-2-3-4-5-6-7-10-30-24-38-34(43-30)39(44(41,42)31-15-16-32-27(22-31)18-21-37-32)29-13-11-26(12-14-29)17-20-36-25-33(40)28-9-8-19-35-23-28/h8-9,11-16,19,22-24,33,36-37,40H,2-7,10,17-18,20-21,25H2,1H3 |
| InChIKey | OZJZNXMSZFNAAB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.82 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|