C33H45N5O4S — CID 100970817
5-[[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]sulfamoyl]-N-methyl-N-octyl-2,3-dihydroindole-1-carboxamide (PubChem CID 100970817) has the molecular formula C33H45N5O4S and a molecular weight of 607.82 g/mol. Its IUPAC name is 5-[[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]sulfamoyl]-N-methyl-N-octyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | 5-[[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]sulfamoyl]-N-methyl-N-octyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 100970817 |
| Molecular Formula | C33H45N5O4S |
| Molecular Weight | 607.82 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | 5-[[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]sulfamoyl]-N-methyl-N-octyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CCCCCCCCN(C)C(=O)N1CCc2cc(S(=O)(=O)Nc3ccc(CCNC[C@H](O)c4cccnc4)cc3)ccc21 |
| InChI | InChI=1S/C33H45N5O4S/c1-3-4-5-6-7-8-21-37(2)33(40)38-22-18-27-23-30(15-16-31(27)38)43(41,42)36-29-13-11-26(12-14-29)17-20-35-25-32(39)28-10-9-19-34-24-28/h9-16,19,23-24,32,35-36,39H,3-8,17-18,20-22,25H2,1-2H3/t32-/m0/s1 |
| InChIKey | RWIFUSBAVGWPMM-YTTGMZPUSA-N |
| XLogP | 5.52 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.82 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|