C28H38N6O4S — CID 67691654
1-[4-[[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]phenyl]-1-hexylurea (PubChem CID 67691654) has the molecular formula C28H38N6O4S and a molecular weight of 554.72 g/mol. Its IUPAC name is 1-[4-[[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]phenyl]-1-hexylurea.
| Compound Name | 1-[4-[[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]phenyl]-1-hexylurea |
|---|---|
| PubChem CID | 67691654 |
| Molecular Formula | C28H38N6O4S |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 1-[4-[[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]phenyl]-1-hexylurea |
| SMILES | CCCCCCN(C(N)=O)c1ccc(S(=O)(=O)Nc2ccc(CCNCC(O)c3ccc(N)nc3)cc2)cc1 |
| InChI | InChI=1S/C28H38N6O4S/c1-2-3-4-5-18-34(28(30)36)24-11-13-25(14-12-24)39(37,38)33-23-9-6-21(7-10-23)16-17-31-20-26(35)22-8-15-27(29)32-19-22/h6-15,19,26,31,33,35H,2-5,16-18,20H2,1H3,(H2,29,32)(H2,30,36) |
| InChIKey | LRAGWBPBHTUSOK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 163.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|