C24H30N6O4S — CID 19420564
3-[4-[[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]phenyl]-1,1-dimethylurea (PubChem CID 19420564) has the molecular formula C24H30N6O4S and a molecular weight of 498.61 g/mol. Its IUPAC name is 3-[4-[[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 19420564 |
| Molecular Formula | C24H30N6O4S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 3-[4-[[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfamoyl]phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(CCNCC(O)c3ccc(N)nc3)cc2)cc1 |
| InChI | InChI=1S/C24H30N6O4S/c1-30(2)24(32)28-19-8-10-21(11-9-19)35(33,34)29-20-6-3-17(4-7-20)13-14-26-16-22(31)18-5-12-23(25)27-15-18/h3-12,15,22,26,29,31H,13-14,16H2,1-2H3,(H2,25,27)(H,28,32) |
| InChIKey | DFNGFYUYIOJVPX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|