C30H38N6O4S — CID 174376522
N-[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]-4-(3-hexyl-2-oxoimidazol-1-yl)benzenesulfonamide (PubChem CID 174376522) has the molecular formula C30H38N6O4S and a molecular weight of 578.74 g/mol. Its IUPAC name is N-[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]-4-(3-hexyl-2-oxoimidazol-1-yl)benzenesulfonamide.
| Compound Name | N-[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]-4-(3-hexyl-2-oxoimidazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 174376522 |
| Molecular Formula | C30H38N6O4S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | N-[4-[2-[[2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]-4-(3-hexyl-2-oxoimidazol-1-yl)benzenesulfonamide |
| SMILES | CCCCCCn1ccn(-c2ccc(S(=O)(=O)Nc3ccc(CCNCC(O)c4ccc(N)nc4)cc3)cc2)c1=O |
| InChI | InChI=1S/C30H38N6O4S/c1-2-3-4-5-18-35-19-20-36(30(35)38)26-11-13-27(14-12-26)41(39,40)34-25-9-6-23(7-10-25)16-17-32-22-28(37)24-8-15-29(31)33-21-24/h6-15,19-21,28,32,34,37H,2-5,16-18,22H2,1H3,(H2,31,33) |
| InChIKey | XUKJDBAVFGJPQZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|