C30H37N7O3S — CID 19420655
4-[2-(3-cyclopentylpropyl)tetrazol-5-yl]-N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]benzenesulfonamide (PubChem CID 19420655) has the molecular formula C30H37N7O3S and a molecular weight of 575.74 g/mol. Its IUPAC name is 4-[2-(3-cyclopentylpropyl)tetrazol-5-yl]-N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 4-[2-(3-cyclopentylpropyl)tetrazol-5-yl]-N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19420655 |
| Molecular Formula | C30H37N7O3S |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 4-[2-(3-cyclopentylpropyl)tetrazol-5-yl]-N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CCNCC(O)c2cccnc2)cc1)c1ccc(-c2nnn(CCCC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C30H37N7O3S/c38-29(26-8-3-18-31-21-26)22-32-19-17-24-9-13-27(14-10-24)35-41(39,40)28-15-11-25(12-16-28)30-33-36-37(34-30)20-4-7-23-5-1-2-6-23/h3,8-16,18,21,23,29,32,35,38H,1-2,4-7,17,19-20,22H2 |
| InChIKey | YDGRTHYUKIEKTQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|