C29H26F2N6O3S — CID 12049916
4-[4-(3,4-difluorophenyl)triazol-2-yl]-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzenesulfonamide (PubChem CID 12049916) has the molecular formula C29H26F2N6O3S and a molecular weight of 576.63 g/mol. Its IUPAC name is 4-[4-(3,4-difluorophenyl)triazol-2-yl]-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 4-[4-(3,4-difluorophenyl)triazol-2-yl]-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 12049916 |
| Molecular Formula | C29H26F2N6O3S |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 4-[4-(3,4-difluorophenyl)triazol-2-yl]-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1)c1ccc(-n2ncc(-c3ccc(F)c(F)c3)n2)cc1 |
| InChI | InChI=1S/C29H26F2N6O3S/c30-26-12-5-21(16-27(26)31)28-18-34-37(35-28)24-8-10-25(11-9-24)41(39,40)36-23-6-3-20(4-7-23)13-15-33-19-29(38)22-2-1-14-32-17-22/h1-12,14,16-18,29,33,36,38H,13,15,19H2/t29-/m0/s1 |
| InChIKey | WHTFIFFVTHLNDG-LJAQVGFWSA-N |
| XLogP | 4.27 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|