C21H32Cl2N4O3S — CID 45261523
(1R)-2-[2-[4-(cyclohexylsulfamoylamino)phenyl]ethylamino]-1-pyridin-3-ylethanol;dihydrochloride (PubChem CID 45261523) has the molecular formula C21H32Cl2N4O3S and a molecular weight of 491.49 g/mol. Its IUPAC name is (1R)-2-[2-[4-(cyclohexylsulfamoylamino)phenyl]ethylamino]-1-pyridin-3-ylethanol;dihydrochloride.
| Compound Name | (1R)-2-[2-[4-(cyclohexylsulfamoylamino)phenyl]ethylamino]-1-pyridin-3-ylethanol;dihydrochloride |
|---|---|
| PubChem CID | 45261523 |
| Molecular Formula | C21H32Cl2N4O3S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (1R)-2-[2-[4-(cyclohexylsulfamoylamino)phenyl]ethylamino]-1-pyridin-3-ylethanol;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C21H30N4O3S.2ClH/c26-21(18-5-4-13-22-15-18)16-23-14-12-17-8-10-20(11-9-17)25-29(27,28)24-19-6-2-1-3-7-19;;/h4-5,8-11,13,15,19,21,23-26H,1-3,6-7,12,14,16H2;2*1H/t21-;;/m0../s1 |
| InChIKey | OJKWXGULFWJOHJ-FGJQBABTSA-N |
| XLogP | 3.37 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|