C27H34N4O4S — CID 10279208
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-3-[(4-methoxyphenyl)methyl]pyrrolidine-1-sulfonamide (PubChem CID 10279208) has the molecular formula C27H34N4O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-3-[(4-methoxyphenyl)methyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-3-[(4-methoxyphenyl)methyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 10279208 |
| Molecular Formula | C27H34N4O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-3-[(4-methoxyphenyl)methyl]pyrrolidine-1-sulfonamide |
| SMILES | COc1ccc(CC2CCN(S(=O)(=O)Nc3ccc(CCNC[C@H](O)c4cccnc4)cc3)C2)cc1 |
| InChI | InChI=1S/C27H34N4O4S/c1-35-26-10-6-22(7-11-26)17-23-13-16-31(20-23)36(33,34)30-25-8-4-21(5-9-25)12-15-29-19-27(32)24-3-2-14-28-18-24/h2-11,14,18,23,27,29-30,32H,12-13,15-17,19-20H2,1H3/t23?,27-/m0/s1 |
| InChIKey | UDDYSYOGRJOLQK-JVHFYALYSA-N |
| XLogP | 3.18 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|