C16H14Cl2N2O — CID 154862277
N-[(3,4-dichlorophenyl)methyl]-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 154862277) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 154862277 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1ccc(Cl)c(Cl)c1)Cc1ccccn1 |
| InChI | InChI=1S/C16H14Cl2N2O/c1-2-16(21)20(11-13-5-3-4-8-19-13)10-12-6-7-14(17)15(18)9-12/h2-9H,1,10-11H2 |
| InChIKey | REYSZVQJLYMCER-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|