C30H25ClN2O4 — CID 74497350
N-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methyl]-3-(2-chlorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 74497350) has the molecular formula C30H25ClN2O4 and a molecular weight of 512.99 g/mol. Its IUPAC name is N-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methyl]-3-(2-chlorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | N-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methyl]-3-(2-chlorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 74497350 |
| Molecular Formula | C30H25ClN2O4 |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | N-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methyl]-3-(2-chlorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)N(Cc1cccc(OCc2ccc3c(c2)OCO3)c1)Cc1ccccn1 |
| InChI | InChI=1S/C30H25ClN2O4/c31-27-10-2-1-7-24(27)12-14-30(34)33(19-25-8-3-4-15-32-25)18-22-6-5-9-26(16-22)35-20-23-11-13-28-29(17-23)37-21-36-28/h1-17H,18-21H2 |
| InChIKey | BPGURDYTJYGEFZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|