C27H27ClN2O3 — CID 42484513
(E)-3-(2-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 42484513) has the molecular formula C27H27ClN2O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 42484513 |
| Molecular Formula | C27H27ClN2O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)N(Cc1ccc(OCc2cccnc2)cc1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C27H27ClN2O3/c28-26-8-2-1-6-23(26)11-14-27(31)30(19-25-7-4-16-32-25)18-21-9-12-24(13-10-21)33-20-22-5-3-15-29-17-22/h1-3,5-6,8-15,17,25H,4,7,16,18-20H2/b14-11+/t25-/m1/s1 |
| InChIKey | YBRXGFQFUKLJRS-IGQYLQMFSA-N |
| XLogP | 5.53 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|