C18H22N2O3 — CID 110026013
3-hydroxy-N-(2-hydroxyethyl)-3-phenyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 110026013) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-hydroxy-N-(2-hydroxyethyl)-3-phenyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | 3-hydroxy-N-(2-hydroxyethyl)-3-phenyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 110026013 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-hydroxy-N-(2-hydroxyethyl)-3-phenyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CC(O)(CC(=O)N(CCO)Cc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3/c1-18(23,16-7-3-2-4-8-16)12-17(22)20(10-11-21)14-15-6-5-9-19-13-15/h2-9,13,21,23H,10-12,14H2,1H3 |
| InChIKey | RJRWDHBBEBKHRH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |