C17H12F6N2O — CID 129051180
N-[3,5-bis(trifluoromethyl)phenyl]-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 129051180) has the molecular formula C17H12F6N2O and a molecular weight of 374.28 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 129051180 |
| Molecular Formula | C17H12F6N2O |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1cccnc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F6N2O/c1-2-15(26)25(10-11-4-3-5-24-9-11)14-7-12(16(18,19)20)6-13(8-14)17(21,22)23/h2-9H,1,10H2 |
| InChIKey | BOOHBGPSOIVVJL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|