C18H19FN4O5 — CID 60598595
N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dinitrobenzamide (PubChem CID 60598595) has the molecular formula C18H19FN4O5 and a molecular weight of 390.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 60598595 |
| Molecular Formula | C18H19FN4O5 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dinitrobenzamide |
| SMILES | CN(C)CCN(Cc1cccc(F)c1)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19FN4O5/c1-20(2)6-7-21(12-13-4-3-5-15(19)8-13)18(24)14-9-16(22(25)26)11-17(10-14)23(27)28/h3-5,8-11H,6-7,12H2,1-2H3 |
| InChIKey | DNQJDOOLLJPHGO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|