C18H18F2IN3O3 — CID 60622808
N-[(3,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-2-iodo-4-nitrobenzamide (PubChem CID 60622808) has the molecular formula C18H18F2IN3O3 and a molecular weight of 489.26 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-2-iodo-4-nitrobenzamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-2-iodo-4-nitrobenzamide |
|---|---|
| PubChem CID | 60622808 |
| Molecular Formula | C18H18F2IN3O3 |
| Molecular Weight | 489.26 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-2-iodo-4-nitrobenzamide |
| SMILES | CN(C)CCN(Cc1ccc(F)c(F)c1)C(=O)c1ccc([N+](=O)[O-])cc1I |
| InChI | InChI=1S/C18H18F2IN3O3/c1-22(2)7-8-23(11-12-3-6-15(19)16(20)9-12)18(25)14-5-4-13(24(26)27)10-17(14)21/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | BHJWUFWICYGVJO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|