C13H17IN2O3 — CID 43317576
2-iodo-5-nitro-N,N-dipropylbenzamide (PubChem CID 43317576) has the molecular formula C13H17IN2O3 and a molecular weight of 376.19 g/mol. Its IUPAC name is 2-iodo-5-nitro-N,N-dipropylbenzamide.
| Compound Name | 2-iodo-5-nitro-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 43317576 |
| Molecular Formula | C13H17IN2O3 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-iodo-5-nitro-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cc([N+](=O)[O-])ccc1I |
| InChI | InChI=1S/C13H17IN2O3/c1-3-7-15(8-4-2)13(17)11-9-10(16(18)19)5-6-12(11)14/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | OXPGXJUIZOTBNR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|