C10H9F2IN2O3 — CID 115611523
N-(2,2-difluoroethyl)-2-iodo-N-methyl-5-nitrobenzamide (PubChem CID 115611523) has the molecular formula C10H9F2IN2O3 and a molecular weight of 370.09 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-iodo-N-methyl-5-nitrobenzamide.
| Compound Name | N-(2,2-difluoroethyl)-2-iodo-N-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 115611523 |
| Molecular Formula | C10H9F2IN2O3 |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-iodo-N-methyl-5-nitrobenzamide |
| SMILES | CN(CC(F)F)C(=O)c1cc([N+](=O)[O-])ccc1I |
| InChI | InChI=1S/C10H9F2IN2O3/c1-14(5-9(11)12)10(16)7-4-6(15(17)18)2-3-8(7)13/h2-4,9H,5H2,1H3 |
| InChIKey | SCFPNJHQDPJNQG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|