C18H22ClN3O3 — CID 120649298
N-(3-aminopropyl)-N-benzyl-2-methyl-4-nitrobenzamide;hydrochloride (PubChem CID 120649298) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-2-methyl-4-nitrobenzamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-N-benzyl-2-methyl-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 120649298 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-2-methyl-4-nitrobenzamide;hydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C(=O)N(CCCN)Cc1ccccc1.Cl |
| InChI | InChI=1S/C18H21N3O3.ClH/c1-14-12-16(21(23)24)8-9-17(14)18(22)20(11-5-10-19)13-15-6-3-2-4-7-15;/h2-4,6-9,12H,5,10-11,13,19H2,1H3;1H |
| InChIKey | XUGMSDQTVSAGRQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|