C11H15N3O3 — CID 62682941
N-(2-aminoethyl)-N,2-dimethyl-4-nitrobenzamide (PubChem CID 62682941) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is N-(2-aminoethyl)-N,2-dimethyl-4-nitrobenzamide.
| Compound Name | N-(2-aminoethyl)-N,2-dimethyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 62682941 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-(2-aminoethyl)-N,2-dimethyl-4-nitrobenzamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C(=O)N(C)CCN |
| InChI | InChI=1S/C11H15N3O3/c1-8-7-9(14(16)17)3-4-10(8)11(15)13(2)6-5-12/h3-4,7H,5-6,12H2,1-2H3 |
| InChIKey | AUEMIHLLGBBFRZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|