C11H17N3O2 — CID 115319475
N'-methyl-N'-(2-methyl-4-nitrophenyl)propane-1,3-diamine (PubChem CID 115319475) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N'-methyl-N'-(2-methyl-4-nitrophenyl)propane-1,3-diamine.
| Compound Name | N'-methyl-N'-(2-methyl-4-nitrophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 115319475 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N'-methyl-N'-(2-methyl-4-nitrophenyl)propane-1,3-diamine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N(C)CCCN |
| InChI | InChI=1S/C11H17N3O2/c1-9-8-10(14(15)16)4-5-11(9)13(2)7-3-6-12/h4-5,8H,3,6-7,12H2,1-2H3 |
| InChIKey | GGHJEQXXBBEVCN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|