C13H16N2O2 — CID 11379268
2-methyl-4-nitro-N,N-bis(prop-2-enyl)aniline (PubChem CID 11379268) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-methyl-4-nitro-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 2-methyl-4-nitro-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 11379268 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-methyl-4-nitro-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCN(CC=C)c1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C13H16N2O2/c1-4-8-14(9-5-2)13-7-6-12(15(16)17)10-11(13)3/h4-7,10H,1-2,8-9H2,3H3 |
| InChIKey | MCVVPONXWXBMSI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|