C17H17N3O7S — CID 100539771
N-(2-methoxy-5-nitrophenyl)-2-methyl-5-nitro-N-prop-2-enylbenzenesulfonamide (PubChem CID 100539771) has the molecular formula C17H17N3O7S and a molecular weight of 407.40 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-methyl-5-nitro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-methyl-5-nitro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 100539771 |
| Molecular Formula | C17H17N3O7S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-methyl-5-nitro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1cc([N+](=O)[O-])ccc1OC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C17H17N3O7S/c1-4-9-18(15-10-13(19(21)22)7-8-16(15)27-3)28(25,26)17-11-14(20(23)24)6-5-12(17)2/h4-8,10-11H,1,9H2,2-3H3 |
| InChIKey | VOYJRNSGUHFFHB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|