C20H22N2O8S — CID 100541205
methyl 4,5-dimethoxy-2-[(2-methyl-5-nitrophenyl)sulfonyl-prop-2-enylamino]benzoate (PubChem CID 100541205) has the molecular formula C20H22N2O8S and a molecular weight of 450.47 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[(2-methyl-5-nitrophenyl)sulfonyl-prop-2-enylamino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[(2-methyl-5-nitrophenyl)sulfonyl-prop-2-enylamino]benzoate |
|---|---|
| PubChem CID | 100541205 |
| Molecular Formula | C20H22N2O8S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[(2-methyl-5-nitrophenyl)sulfonyl-prop-2-enylamino]benzoate |
| SMILES | C=CCN(c1cc(OC)c(OC)cc1C(=O)OC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C20H22N2O8S/c1-6-9-21(31(26,27)19-10-14(22(24)25)8-7-13(19)2)16-12-18(29-4)17(28-3)11-15(16)20(23)30-5/h6-8,10-12H,1,9H2,2-5H3 |
| InChIKey | UZWSSZRIKWEFBX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|