C10H14ClN3O2 — CID 104839457
N'-(3-chloro-2-nitrophenyl)-N'-methylpropane-1,3-diamine (PubChem CID 104839457) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is N'-(3-chloro-2-nitrophenyl)-N'-methylpropane-1,3-diamine.
| Compound Name | N'-(3-chloro-2-nitrophenyl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 104839457 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | N'-(3-chloro-2-nitrophenyl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCN)c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14ClN3O2/c1-13(7-3-6-12)9-5-2-4-8(11)10(9)14(15)16/h2,4-5H,3,6-7,12H2,1H3 |
| InChIKey | NPYSRVUYYMQIHH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|