C22H33NO6S2 — CID 56985616
tert-butyl (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(3-hydroxypropylsulfanyl)-3-methylbutanoate (PubChem CID 56985616) has the molecular formula C22H33NO6S2 and a molecular weight of 471.64 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(3-hydroxypropylsulfanyl)-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(3-hydroxypropylsulfanyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 56985616 |
| Molecular Formula | C22H33NO6S2 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | tert-butyl (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(3-hydroxypropylsulfanyl)-3-methylbutanoate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@@H](C(=O)OC(C)(C)C)C(C)(C)SCCCO)cc1 |
| InChI | InChI=1S/C22H33NO6S2/c1-7-8-15-28-17-10-12-18(13-11-17)31(26,27)23-19(20(25)29-21(2,3)4)22(5,6)30-16-9-14-24/h10-13,19,23-24H,9,14-16H2,1-6H3/t19-/m0/s1 |
| InChIKey | BZMHUVHNTFSPMF-IBGZPJMESA-N |
| XLogP | 2.97 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|