C17H21O6S2- — CID 22644985
2-(4-but-2-ynoxyphenyl)sulfonyl-3-(2-hydroxyethylsulfanyl)-3-methylbutanoate (PubChem CID 22644985) has the molecular formula C17H21O6S2- and a molecular weight of 385.48 g/mol. Its IUPAC name is 2-(4-but-2-ynoxyphenyl)sulfonyl-3-(2-hydroxyethylsulfanyl)-3-methylbutanoate.
| Compound Name | 2-(4-but-2-ynoxyphenyl)sulfonyl-3-(2-hydroxyethylsulfanyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 22644985 |
| Molecular Formula | C17H21O6S2- |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-(4-but-2-ynoxyphenyl)sulfonyl-3-(2-hydroxyethylsulfanyl)-3-methylbutanoate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C(C(=O)[O-])C(C)(C)SCCO)cc1 |
| InChI | InChI=1S/C17H22O6S2/c1-4-5-11-23-13-6-8-14(9-7-13)25(21,22)15(16(19)20)17(2,3)24-12-10-18/h6-9,15,18H,10-12H2,1-3H3,(H,19,20)/p-1 |
| InChIKey | MTJLOSVKKFKTTI-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|