C28H36N2O6S2 — CID 59756970
ethyl 2-[1-benzyl-4-(2-hydroxyethylsulfanyl)piperidin-4-yl]-2-[(4-but-2-ynoxyphenyl)sulfonylamino]acetate (PubChem CID 59756970) has the molecular formula C28H36N2O6S2 and a molecular weight of 560.74 g/mol. Its IUPAC name is ethyl 2-[1-benzyl-4-(2-hydroxyethylsulfanyl)piperidin-4-yl]-2-[(4-but-2-ynoxyphenyl)sulfonylamino]acetate.
| Compound Name | ethyl 2-[1-benzyl-4-(2-hydroxyethylsulfanyl)piperidin-4-yl]-2-[(4-but-2-ynoxyphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 59756970 |
| Molecular Formula | C28H36N2O6S2 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | ethyl 2-[1-benzyl-4-(2-hydroxyethylsulfanyl)piperidin-4-yl]-2-[(4-but-2-ynoxyphenyl)sulfonylamino]acetate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(C(=O)OCC)C2(SCCO)CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H36N2O6S2/c1-3-5-20-36-24-11-13-25(14-12-24)38(33,34)29-26(27(32)35-4-2)28(37-21-19-31)15-17-30(18-16-28)22-23-9-7-6-8-10-23/h6-14,26,29,31H,4,15-22H2,1-2H3 |
| InChIKey | LENVRDXSGOIXAU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|