C23H26BrClN2O5S — CID 11261471
1-[(4-bromophenyl)methyl]-4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride (PubChem CID 11261471) has the molecular formula C23H26BrClN2O5S and a molecular weight of 557.89 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 11261471 |
| Molecular Formula | C23H26BrClN2O5S |
| Molecular Weight | 557.89 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCN(Cc3ccc(Br)cc3)CC2)cc1.Cl |
| InChI | InChI=1S/C23H25BrN2O5S.ClH/c1-2-3-16-31-20-8-10-21(11-9-20)32(29,30)23(22(27)25-28)12-14-26(15-13-23)17-18-4-6-19(24)7-5-18;/h4-11,28H,12-17H2,1H3,(H,25,27);1H |
| InChIKey | HEPOIQYENAEIBZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.89 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|