C21H30N2O5S — CID 54108312
4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1-pentan-3-ylpiperidine-4-carboxamide (PubChem CID 54108312) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is 4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1-pentan-3-ylpiperidine-4-carboxamide.
| Compound Name | 4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1-pentan-3-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 54108312 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1-pentan-3-ylpiperidine-4-carboxamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCN(C(CC)CC)CC2)cc1 |
| InChI | InChI=1S/C21H30N2O5S/c1-4-7-16-28-18-8-10-19(11-9-18)29(26,27)21(20(24)22-25)12-14-23(15-13-21)17(5-2)6-3/h8-11,17,25H,5-6,12-16H2,1-3H3,(H,22,24) |
| InChIKey | NFHOUQOTNHPMQD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|