C24H33ClN2O6S — CID 172866930
N-hydroxy-1-propan-2-yl-4-[4-(4-propan-2-yloxyphenoxy)phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 172866930) has the molecular formula C24H33ClN2O6S and a molecular weight of 513.06 g/mol. Its IUPAC name is N-hydroxy-1-propan-2-yl-4-[4-(4-propan-2-yloxyphenoxy)phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-1-propan-2-yl-4-[4-(4-propan-2-yloxyphenoxy)phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172866930 |
| Molecular Formula | C24H33ClN2O6S |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | N-hydroxy-1-propan-2-yl-4-[4-(4-propan-2-yloxyphenoxy)phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CC(C)Oc1ccc(Oc2ccc(S(=O)(=O)C3(C(=O)NO)CCN(C(C)C)CC3)cc2)cc1.Cl |
| InChI | InChI=1S/C24H32N2O6S.ClH/c1-17(2)26-15-13-24(14-16-26,23(27)25-28)33(29,30)22-11-9-21(10-12-22)32-20-7-5-19(6-8-20)31-18(3)4;/h5-12,17-18,28H,13-16H2,1-4H3,(H,25,27);1H |
| InChIKey | FGBBUQXXQATTIQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|