C21H23ClN2O8S — CID 169429684
1-acetyl-4-[4-(1,3-benzodioxol-5-yloxy)phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride (PubChem CID 169429684) has the molecular formula C21H23ClN2O8S and a molecular weight of 498.94 g/mol. Its IUPAC name is 1-acetyl-4-[4-(1,3-benzodioxol-5-yloxy)phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-acetyl-4-[4-(1,3-benzodioxol-5-yloxy)phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 169429684 |
| Molecular Formula | C21H23ClN2O8S |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 1-acetyl-4-[4-(1,3-benzodioxol-5-yloxy)phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride |
| SMILES | CC(=O)N1CCC(C(=O)NO)(S(=O)(=O)c2ccc(Oc3ccc4c(c3)OCO4)cc2)CC1.Cl |
| InChI | InChI=1S/C21H22N2O8S.ClH/c1-14(24)23-10-8-21(9-11-23,20(25)22-26)32(27,28)17-5-2-15(3-6-17)31-16-4-7-18-19(12-16)30-13-29-18;/h2-7,12,26H,8-11,13H2,1H3,(H,22,25);1H |
| InChIKey | IGUMLXXKVGONCC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|