C22H26ClF3N2O6S2 — CID 172742819
N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(trifluoromethylsulfanyl)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 172742819) has the molecular formula C22H26ClF3N2O6S2 and a molecular weight of 571.04 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(trifluoromethylsulfanyl)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(trifluoromethylsulfanyl)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172742819 |
| Molecular Formula | C22H26ClF3N2O6S2 |
| Molecular Weight | 571.04 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(trifluoromethylsulfanyl)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(Oc3ccc(SC(F)(F)F)cc3)cc2)CC1.Cl |
| InChI | InChI=1S/C22H25F3N2O6S2.ClH/c1-32-15-14-27-12-10-21(11-13-27,20(28)26-29)35(30,31)19-8-4-17(5-9-19)33-16-2-6-18(7-3-16)34-22(23,24)25;/h2-9,29H,10-15H2,1H3,(H,26,28);1H |
| InChIKey | JIBYGFVJRDCUOS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.04 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|