C23H27ClN2O7S — CID 131723836
4-[4-(3,4-dimethoxyphenoxy)phenyl]sulfonyl-N-hydroxy-1-prop-2-ynylpiperidine-4-carboxamide;hydrochloride (PubChem CID 131723836) has the molecular formula C23H27ClN2O7S and a molecular weight of 511.00 g/mol. Its IUPAC name is 4-[4-(3,4-dimethoxyphenoxy)phenyl]sulfonyl-N-hydroxy-1-prop-2-ynylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-[4-(3,4-dimethoxyphenoxy)phenyl]sulfonyl-N-hydroxy-1-prop-2-ynylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 131723836 |
| Molecular Formula | C23H27ClN2O7S |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 4-[4-(3,4-dimethoxyphenoxy)phenyl]sulfonyl-N-hydroxy-1-prop-2-ynylpiperidine-4-carboxamide;hydrochloride |
| SMILES | C#CCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(Oc3ccc(OC)c(OC)c3)cc2)CC1.Cl |
| InChI | InChI=1S/C23H26N2O7S.ClH/c1-4-13-25-14-11-23(12-15-25,22(26)24-27)33(28,29)19-8-5-17(6-9-19)32-18-7-10-20(30-2)21(16-18)31-3;/h1,5-10,16,27H,11-15H2,2-3H3,(H,24,26);1H |
| InChIKey | JJRNHYHFUHSTKZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|