C21H21ClN2O5S — CID 22485255
4-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxy-1-prop-2-ynylpiperidine-4-carboxamide (PubChem CID 22485255) has the molecular formula C21H21ClN2O5S and a molecular weight of 448.93 g/mol. Its IUPAC name is 4-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxy-1-prop-2-ynylpiperidine-4-carboxamide.
| Compound Name | 4-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxy-1-prop-2-ynylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22485255 |
| Molecular Formula | C21H21ClN2O5S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 4-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxy-1-prop-2-ynylpiperidine-4-carboxamide |
| SMILES | C#CCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H21ClN2O5S/c1-2-13-24-14-11-21(12-15-24,20(25)23-26)30(27,28)19-9-7-18(8-10-19)29-17-5-3-16(22)4-6-17/h1,3-10,26H,11-15H2,(H,23,25) |
| InChIKey | AFLLETHUOHPICN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|