C23H29ClN2O7S — CID 11598734
tert-butyl 4-(hydroxycarbamoyl)-4-(4-phenoxyphenyl)sulfonylpiperidine-1-carboxylate;hydrochloride (PubChem CID 11598734) has the molecular formula C23H29ClN2O7S and a molecular weight of 513.01 g/mol. Its IUPAC name is tert-butyl 4-(hydroxycarbamoyl)-4-(4-phenoxyphenyl)sulfonylpiperidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 4-(hydroxycarbamoyl)-4-(4-phenoxyphenyl)sulfonylpiperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 11598734 |
| Molecular Formula | C23H29ClN2O7S |
| Molecular Weight | 513.01 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | tert-butyl 4-(hydroxycarbamoyl)-4-(4-phenoxyphenyl)sulfonylpiperidine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NO)(S(=O)(=O)c2ccc(Oc3ccccc3)cc2)CC1.Cl |
| InChI | InChI=1S/C23H28N2O7S.ClH/c1-22(2,3)32-21(27)25-15-13-23(14-16-25,20(26)24-28)33(29,30)19-11-9-18(10-12-19)31-17-7-5-4-6-8-17;/h4-12,28H,13-16H2,1-3H3,(H,24,26);1H |
| InChIKey | SFHFYGWDJMCVNF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.01 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|