C20H20F3N3O6S2 — CID 142028448
1-carbamothioyl-N-hydroxy-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 142028448) has the molecular formula C20H20F3N3O6S2 and a molecular weight of 519.52 g/mol. Its IUPAC name is 1-carbamothioyl-N-hydroxy-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-carbamothioyl-N-hydroxy-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142028448 |
| Molecular Formula | C20H20F3N3O6S2 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 1-carbamothioyl-N-hydroxy-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | NC(=S)N1CCC(C(=O)NO)(S(=O)(=O)c2ccc(Oc3ccc(OC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H20F3N3O6S2/c21-20(22,23)32-15-3-1-13(2-4-15)31-14-5-7-16(8-6-14)34(29,30)19(17(27)25-28)9-11-26(12-10-19)18(24)33/h1-8,28H,9-12H2,(H2,24,33)(H,25,27) |
| InChIKey | MYHFBXILUGBBTB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|