C26H23F3N2O7S — CID 22707809
1-benzoyl-N-hydroxy-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 22707809) has the molecular formula C26H23F3N2O7S and a molecular weight of 564.54 g/mol. Its IUPAC name is 1-benzoyl-N-hydroxy-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-hydroxy-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22707809 |
| Molecular Formula | C26H23F3N2O7S |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 1-benzoyl-N-hydroxy-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(c1ccccc1)N1CCC(C(=O)NO)(S(=O)(=O)c2ccc(Oc3ccc(OC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H23F3N2O7S/c27-26(28,29)38-21-8-6-19(7-9-21)37-20-10-12-22(13-11-20)39(35,36)25(24(33)30-34)14-16-31(17-15-25)23(32)18-4-2-1-3-5-18/h1-13,34H,14-17H2,(H,30,33) |
| InChIKey | NOEQJAXDROUGSX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|