C26H23F3N2O4S — CID 142028510
1-benzoyl-N-hydroxy-4-[4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylpiperidine-4-carboxamide (PubChem CID 142028510) has the molecular formula C26H23F3N2O4S and a molecular weight of 516.54 g/mol. Its IUPAC name is 1-benzoyl-N-hydroxy-4-[4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylpiperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-hydroxy-4-[4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142028510 |
| Molecular Formula | C26H23F3N2O4S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 1-benzoyl-N-hydroxy-4-[4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylpiperidine-4-carboxamide |
| SMILES | O=C(c1ccccc1)N1CCC(Sc2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)(C(=O)NO)CC1 |
| InChI | InChI=1S/C26H23F3N2O4S/c27-26(28,29)19-6-8-20(9-7-19)35-21-10-12-22(13-11-21)36-25(24(33)30-34)14-16-31(17-15-25)23(32)18-4-2-1-3-5-18/h1-13,34H,14-17H2,(H,30,33) |
| InChIKey | RBJNRHBKUMFNNR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|