C26H26F3N3O3S — CID 142005420
N-hydroxy-1-(pyridin-4-ylmethyl)-4-[4-[4-(trifluoromethyl)phenoxy]cyclohepta-1,3,5-trien-1-yl]sulfanylpiperidine-4-carboxamide (PubChem CID 142005420) has the molecular formula C26H26F3N3O3S and a molecular weight of 517.57 g/mol. Its IUPAC name is N-hydroxy-1-(pyridin-4-ylmethyl)-4-[4-[4-(trifluoromethyl)phenoxy]cyclohepta-1,3,5-trien-1-yl]sulfanylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(pyridin-4-ylmethyl)-4-[4-[4-(trifluoromethyl)phenoxy]cyclohepta-1,3,5-trien-1-yl]sulfanylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142005420 |
| Molecular Formula | C26H26F3N3O3S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | N-hydroxy-1-(pyridin-4-ylmethyl)-4-[4-[4-(trifluoromethyl)phenoxy]cyclohepta-1,3,5-trien-1-yl]sulfanylpiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(SC2=CC=C(Oc3ccc(C(F)(F)F)cc3)C=CC2)CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C26H26F3N3O3S/c27-26(28,29)20-4-6-22(7-5-20)35-21-2-1-3-23(9-8-21)36-25(24(33)31-34)12-16-32(17-13-25)18-19-10-14-30-15-11-19/h1-2,4-11,14-15,34H,3,12-13,16-18H2,(H,31,33) |
| InChIKey | GZQGDKSUFSQLGM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|