C15H18F3NO3 — CID 84582397
(4,4-dimethoxypiperidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 84582397) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is (4,4-dimethoxypiperidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | (4,4-dimethoxypiperidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 84582397 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (4,4-dimethoxypiperidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | COC1(OC)CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H18F3NO3/c1-21-14(22-2)7-9-19(10-8-14)13(20)11-3-5-12(6-4-11)15(16,17)18/h3-6H,7-10H2,1-2H3 |
| InChIKey | VPMNIMQLIHEXED-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|