C19H25F3N2O2 — CID 91916421
[4-(1-methylpiperidin-4-yl)oxypiperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 91916421) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is [4-(1-methylpiperidin-4-yl)oxypiperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(1-methylpiperidin-4-yl)oxypiperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 91916421 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [4-(1-methylpiperidin-4-yl)oxypiperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | CN1CCC(OC2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C19H25F3N2O2/c1-23-10-6-16(7-11-23)26-17-8-12-24(13-9-17)18(25)14-2-4-15(5-3-14)19(20,21)22/h2-5,16-17H,6-13H2,1H3 |
| InChIKey | JUTRKGPDBSFXHL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |