C20H24F3NO3 — CID 55486099
cyclohexyl 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 55486099) has the molecular formula C20H24F3NO3 and a molecular weight of 383.41 g/mol. Its IUPAC name is cyclohexyl 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | cyclohexyl 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55486099 |
| Molecular Formula | C20H24F3NO3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | cyclohexyl 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | O=C(OC1CCCCC1)C1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H24F3NO3/c21-20(22,23)16-8-6-14(7-9-16)18(25)24-12-10-15(11-13-24)19(26)27-17-4-2-1-3-5-17/h6-9,15,17H,1-5,10-13H2 |
| InChIKey | WDKKTHVERFTVAG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |