C23H30F3N3O2 — CID 55584059
(4-cyclopentylpiperazin-1-yl)-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]methanone (PubChem CID 55584059) has the molecular formula C23H30F3N3O2 and a molecular weight of 437.51 g/mol. Its IUPAC name is (4-cyclopentylpiperazin-1-yl)-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]methanone.
| Compound Name | (4-cyclopentylpiperazin-1-yl)-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55584059 |
| Molecular Formula | C23H30F3N3O2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (4-cyclopentylpiperazin-1-yl)-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCC(C(=O)N2CCN(C3CCCC3)CC2)CC1 |
| InChI | InChI=1S/C23H30F3N3O2/c24-23(25,26)19-7-5-17(6-8-19)21(30)28-11-9-18(10-12-28)22(31)29-15-13-27(14-16-29)20-3-1-2-4-20/h5-8,18,20H,1-4,9-16H2 |
| InChIKey | IVMPQCCXDFCMCH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |