C19H25F3N2O — CID 113074934
(4-cycloheptylpiperazin-1-yl)-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 113074934) has the molecular formula C19H25F3N2O and a molecular weight of 354.42 g/mol. Its IUPAC name is (4-cycloheptylpiperazin-1-yl)-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | (4-cycloheptylpiperazin-1-yl)-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 113074934 |
| Molecular Formula | C19H25F3N2O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (4-cycloheptylpiperazin-1-yl)-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCN(C2CCCCCC2)CC1 |
| InChI | InChI=1S/C19H25F3N2O/c20-19(21,22)16-9-7-15(8-10-16)18(25)24-13-11-23(12-14-24)17-5-3-1-2-4-6-17/h7-10,17H,1-6,11-14H2 |
| InChIKey | RWZOLMIWXKAACV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |